C22H32FN3O3 — CID 42595229
(3R)-4-[(2-fluorophenyl)methyl]-3-[2-[4-(3-methoxypropyl)piperidin-1-yl]-2-oxoethyl]piperazin-2-one (PubChem CID 42595229) has the molecular formula C22H32FN3O3 and a molecular weight of 405.51 g/mol. Its IUPAC name is (3R)-4-[(2-fluorophenyl)methyl]-3-[2-[4-(3-methoxypropyl)piperidin-1-yl]-2-oxoethyl]piperazin-2-one.
| Compound Name | (3R)-4-[(2-fluorophenyl)methyl]-3-[2-[4-(3-methoxypropyl)piperidin-1-yl]-2-oxoethyl]piperazin-2-one |
|---|---|
| PubChem CID | 42595229 |
| Molecular Formula | C22H32FN3O3 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (3R)-4-[(2-fluorophenyl)methyl]-3-[2-[4-(3-methoxypropyl)piperidin-1-yl]-2-oxoethyl]piperazin-2-one |
| SMILES | COCCCC1CCN(C(=O)C[C@@H]2C(=O)NCCN2Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C22H32FN3O3/c1-29-14-4-5-17-8-11-25(12-9-17)21(27)15-20-22(28)24-10-13-26(20)16-18-6-2-3-7-19(18)23/h2-3,6-7,17,20H,4-5,8-16H2,1H3,(H,24,28)/t20-/m1/s1 |
| InChIKey | MQOSYOGFVVXYOO-HXUWFJFHSA-N |
| XLogP | 2.18 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|