C25H27N3O3S — CID 42599827
[2-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[(2R)-oxolan-2-yl]methanone (PubChem CID 42599827) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is [2-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[(2R)-oxolan-2-yl]methanone.
| Compound Name | [2-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[(2R)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 42599827 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | [2-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[(2R)-oxolan-2-yl]methanone |
| SMILES | O=C([C@H]1CCCO1)N1CC2CN(Cc3ccc(Oc4nc5ccccc5s4)cc3)CC2C1 |
| InChI | InChI=1S/C25H27N3O3S/c29-24(22-5-3-11-30-22)28-15-18-13-27(14-19(18)16-28)12-17-7-9-20(10-8-17)31-25-26-21-4-1-2-6-23(21)32-25/h1-2,4,6-10,18-19,22H,3,5,11-16H2/t18?,19?,22-/m1/s1 |
| InChIKey | QVQQAHGAVLGIBH-OBFZPWGMSA-N |
| XLogP | 4.16 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |