C29H24F3N5O5 — CID 42601201
5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]pyrazole-3-carboxamide (PubChem CID 42601201) has the molecular formula C29H24F3N5O5 and a molecular weight of 579.54 g/mol. Its IUPAC name is 5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]pyrazole-3-carboxamide.
| Compound Name | 5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 42601201 |
| Molecular Formula | C29H24F3N5O5 |
| Molecular Weight | 579.54 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccccc1-c1cc(C(=O)NCc2ccc(OC(F)(F)F)cc2)nn1CC1CC(c2cccc([N+](=O)[O-])c2)=NO1 |
| InChI | InChI=1S/C29H24F3N5O5/c1-18-5-2-3-8-24(18)27-15-26(28(38)33-16-19-9-11-22(12-10-19)41-29(30,31)32)34-36(27)17-23-14-25(35-42-23)20-6-4-7-21(13-20)37(39)40/h2-13,15,23H,14,16-17H2,1H3,(H,33,38) |
| InChIKey | LEDKLVVZSNCMOI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|