C33H38BrNO5S2 — CID 42602520
2-[2-[[4-[3-(4-methylphenyl)sulfanyl-2-[(4-methylphenyl)sulfanylmethyl]propanoyl]benzoyl]amino]ethoxy]ethyl 2-bromo-2-methylpropanoate (PubChem CID 42602520) has the molecular formula C33H38BrNO5S2 and a molecular weight of 672.71 g/mol. Its IUPAC name is 2-[2-[[4-[3-(4-methylphenyl)sulfanyl-2-[(4-methylphenyl)sulfanylmethyl]propanoyl]benzoyl]amino]ethoxy]ethyl 2-bromo-2-methylpropanoate.
| Compound Name | 2-[2-[[4-[3-(4-methylphenyl)sulfanyl-2-[(4-methylphenyl)sulfanylmethyl]propanoyl]benzoyl]amino]ethoxy]ethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 42602520 |
| Molecular Formula | C33H38BrNO5S2 |
| Molecular Weight | 672.71 g/mol |
| Exact Mass | 671.14 |
| IUPAC Name | 2-[2-[[4-[3-(4-methylphenyl)sulfanyl-2-[(4-methylphenyl)sulfanylmethyl]propanoyl]benzoyl]amino]ethoxy]ethyl 2-bromo-2-methylpropanoate |
| SMILES | Cc1ccc(SCC(CSc2ccc(C)cc2)C(=O)c2ccc(C(=O)NCCOCCOC(=O)C(C)(C)Br)cc2)cc1 |
| InChI | InChI=1S/C33H38BrNO5S2/c1-23-5-13-28(14-6-23)41-21-27(22-42-29-15-7-24(2)8-16-29)30(36)25-9-11-26(12-10-25)31(37)35-17-18-39-19-20-40-32(38)33(3,4)34/h5-16,27H,17-22H2,1-4H3,(H,35,37) |
| InChIKey | AEXBEGVWABUQJL-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|