C20H20BrNO4 — CID 8574552
[(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(4-bromobenzoyl)amino]propanoate (PubChem CID 8574552) has the molecular formula C20H20BrNO4 and a molecular weight of 418.29 g/mol. Its IUPAC name is [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(4-bromobenzoyl)amino]propanoate.
| Compound Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(4-bromobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 8574552 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 3-[(4-bromobenzoyl)amino]propanoate |
| SMILES | Cc1ccc(C(=O)[C@@H](C)OC(=O)CCNC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H20BrNO4/c1-13-3-5-15(6-4-13)19(24)14(2)26-18(23)11-12-22-20(25)16-7-9-17(21)10-8-16/h3-10,14H,11-12H2,1-2H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | TZMPYBLVVIAWAF-CQSZACIVSA-N |
| XLogP | 3.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |