C26H44O3Si — CID 42603941
triethyl-[[(1R,3R,4S,7E,11S,12R,13S,15R)-3,4,7,11-tetramethyl-17-methylidene-14,16-dioxatetracyclo[9.4.1.14,15.013,15]heptadec-7-en-12-yl]oxy]silane (PubChem CID 42603941) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is triethyl-[[(1R,3R,4S,7E,11S,12R,13S,15R)-3,4,7,11-tetramethyl-17-methylidene-14,16-dioxatetracyclo[9.4.1.14,15.013,15]heptadec-7-en-12-yl]oxy]silane.
| Compound Name | triethyl-[[(1R,3R,4S,7E,11S,12R,13S,15R)-3,4,7,11-tetramethyl-17-methylidene-14,16-dioxatetracyclo[9.4.1.14,15.013,15]heptadec-7-en-12-yl]oxy]silane |
|---|---|
| PubChem CID | 42603941 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | triethyl-[[(1R,3R,4S,7E,11S,12R,13S,15R)-3,4,7,11-tetramethyl-17-methylidene-14,16-dioxatetracyclo[9.4.1.14,15.013,15]heptadec-7-en-12-yl]oxy]silane |
| SMILES | C=C1[C@]23O[C@H]2[C@@H](O[Si](CC)(CC)CC)[C@]2(C)CC/C=C(/C)CC[C@@]1(C)[C@H](C)C[C@H]3O2 |
| InChI | InChI=1S/C26H44O3Si/c1-9-30(10-2,11-3)29-22-23-26(28-23)20(6)24(7)16-14-18(4)13-12-15-25(22,8)27-21(26)17-19(24)5/h13,19,21-23H,6,9-12,14-17H2,1-5,7-8H3/b18-13-/t19-,21-,22-,23+,24+,25+,26-/m1/s1 |
| InChIKey | AOJYZYGTIRCORB-NBNBOZOASA-N |
| XLogP | 6.79 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|