C26H21FN2O5 — CID 42605144
2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-3-hydroxy-2,3-dimethoxychromen-4-one (PubChem CID 42605144) has the molecular formula C26H21FN2O5 and a molecular weight of 460.46 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-3-hydroxy-2,3-dimethoxychromen-4-one.
| Compound Name | 2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-3-hydroxy-2,3-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 42605144 |
| Molecular Formula | C26H21FN2O5 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-3-hydroxy-2,3-dimethoxychromen-4-one |
| SMILES | COC1(O)C(=O)c2ccccc2OC1(OC)c1cn(-c2ccccc2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21FN2O5/c1-32-25(31)24(30)20-10-6-7-11-22(20)34-26(25,33-2)21-16-29(19-8-4-3-5-9-19)28-23(21)17-12-14-18(27)15-13-17/h3-16,31H,1-2H3 |
| InChIKey | UHCVHJHATKRASV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|