C32H54O3 — CID 42608296
(1R,2R,4R,5R,7S,10R,11S,14R,15R,18S)-4-ethoxy-1,2,10,15,19,19-hexamethyl-7-propan-2-yl-6-oxahexacyclo[12.8.0.02,11.05,7.05,10.015,20]docosan-18-ol (PubChem CID 42608296) has the molecular formula C32H54O3 and a molecular weight of 486.78 g/mol. Its IUPAC name is (1R,2R,4R,5R,7S,10R,11S,14R,15R,18S)-4-ethoxy-1,2,10,15,19,19-hexamethyl-7-propan-2-yl-6-oxahexacyclo[12.8.0.02,11.05,7.05,10.015,20]docosan-18-ol.
| Compound Name | (1R,2R,4R,5R,7S,10R,11S,14R,15R,18S)-4-ethoxy-1,2,10,15,19,19-hexamethyl-7-propan-2-yl-6-oxahexacyclo[12.8.0.02,11.05,7.05,10.015,20]docosan-18-ol |
|---|---|
| PubChem CID | 42608296 |
| Molecular Formula | C32H54O3 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | (1R,2R,4R,5R,7S,10R,11S,14R,15R,18S)-4-ethoxy-1,2,10,15,19,19-hexamethyl-7-propan-2-yl-6-oxahexacyclo[12.8.0.02,11.05,7.05,10.015,20]docosan-18-ol |
| SMILES | CCO[C@@H]1C[C@]2(C)[C@H](CC[C@@H]3[C@@]4(C)CC[C@H](O)C(C)(C)C4CC[C@]32C)[C@@]2(C)CC[C@@]3(C(C)C)O[C@]132 |
| InChI | InChI=1S/C32H54O3/c1-10-34-25-19-30(9)23(29(8)17-18-31(20(2)3)32(25,29)35-31)12-11-22-27(6)15-14-24(33)26(4,5)21(27)13-16-28(22,30)7/h20-25,33H,10-19H2,1-9H3/t21?,22-,23-,24+,25-,27+,28-,29-,30-,31+,32+/m1/s1 |
| InChIKey | VXGFTFVZVXNHMW-YXSZZDAOSA-N |
| XLogP | 7.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|