C30H54O — CID 610270
1,1,4a,8,10a,10b-hexamethyl-8-(4-methylpentyl)-3,4,4b,5,6,6a,7,9,10,11,12,12a-dodecahydro-2H-chrysen-2-ol (PubChem CID 610270) has the molecular formula C30H54O and a molecular weight of 430.76 g/mol. Its IUPAC name is 1,1,4a,8,10a,10b-hexamethyl-8-(4-methylpentyl)-3,4,4b,5,6,6a,7,9,10,11,12,12a-dodecahydro-2H-chrysen-2-ol.
| Compound Name | 1,1,4a,8,10a,10b-hexamethyl-8-(4-methylpentyl)-3,4,4b,5,6,6a,7,9,10,11,12,12a-dodecahydro-2H-chrysen-2-ol |
|---|---|
| PubChem CID | 610270 |
| Molecular Formula | C30H54O |
| Molecular Weight | 430.76 g/mol |
| Exact Mass | 430.42 |
| IUPAC Name | 1,1,4a,8,10a,10b-hexamethyl-8-(4-methylpentyl)-3,4,4b,5,6,6a,7,9,10,11,12,12a-dodecahydro-2H-chrysen-2-ol |
| SMILES | CC(C)CCCC1(C)CCC2(C)C(CCC3C4(C)CCC(O)C(C)(C)C4CCC32C)C1 |
| InChI | InChI=1S/C30H54O/c1-21(2)10-9-15-27(5)18-19-29(7)22(20-27)11-12-24-28(6)16-14-25(31)26(3,4)23(28)13-17-30(24,29)8/h21-25,31H,9-20H2,1-8H3 |
| InChIKey | QVMYVMAZODTVEI-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.76 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |