C9H16ClN — CID 42608910
2-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 42608910) has the molecular formula C9H16ClN and a molecular weight of 173.69 g/mol. Its IUPAC name is 2-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | 2-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 42608910 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2-chloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | ClC1CCC2CCCCC2N1 |
| InChI | InChI=1S/C9H16ClN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h7-9,11H,1-6H2 |
| InChIKey | KSOWQNPUYLXPKB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|