C21H17F3N4 — CID 42609197
3-(1-methylpyrazol-4-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinolin-6-amine (PubChem CID 42609197) has the molecular formula C21H17F3N4 and a molecular weight of 382.39 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinolin-6-amine.
| Compound Name | 3-(1-methylpyrazol-4-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinolin-6-amine |
|---|---|
| PubChem CID | 42609197 |
| Molecular Formula | C21H17F3N4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinolin-6-amine |
| SMILES | Cn1cc(-c2cnc3ccc(NCc4cccc(C(F)(F)F)c4)cc3c2)cn1 |
| InChI | InChI=1S/C21H17F3N4/c1-28-13-17(12-27-28)16-8-15-9-19(5-6-20(15)26-11-16)25-10-14-3-2-4-18(7-14)21(22,23)24/h2-9,11-13,25H,10H2,1H3 |
| InChIKey | WFWJNUHMKXUPON-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |