C10H9N3OS — CID 42609228
2-amino-N-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 42609228) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-amino-N-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 42609228 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-amino-N-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Nc1ncc(C(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C10H9N3OS/c11-10-12-6-8(15-10)9(14)13-7-4-2-1-3-5-7/h1-6H,(H2,11,12)(H,13,14) |
| InChIKey | LJVVNVSKFUUHNH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |