C16H16Cl2N2O — CID 42609411
1-[(5-chloro-2-methylphenyl)methyl]-3-[(3-chlorophenyl)methyl]urea (PubChem CID 42609411) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 1-[(5-chloro-2-methylphenyl)methyl]-3-[(3-chlorophenyl)methyl]urea.
| Compound Name | 1-[(5-chloro-2-methylphenyl)methyl]-3-[(3-chlorophenyl)methyl]urea |
|---|---|
| PubChem CID | 42609411 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-[(5-chloro-2-methylphenyl)methyl]-3-[(3-chlorophenyl)methyl]urea |
| SMILES | Cc1ccc(Cl)cc1CNC(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-11-5-6-15(18)8-13(11)10-20-16(21)19-9-12-3-2-4-14(17)7-12/h2-8H,9-10H2,1H3,(H2,19,20,21) |
| InChIKey | IURBDDHTDCDIRT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |