C12H12FNOS — CID 42609894
2-(4-fluorophenyl)-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 42609894) has the molecular formula C12H12FNOS and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-fluorophenyl)-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 42609894 |
| Molecular Formula | C12H12FNOS |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-(4-fluorophenyl)-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)CSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FNOS/c1-2-7-14-11(15)8-16-12(14)9-3-5-10(13)6-4-9/h2-6,12H,1,7-8H2 |
| InChIKey | BXNCYKYARLVVSH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|