C30H34O12 — CID 42610671
[(1S,2S,5S,9R,14R,15R,18R,21S,24R,26S)-14,15-dihydroxy-2,9,26-trimethyl-4,10,22,29-tetraoxo-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-en-5-yl] acetate (PubChem CID 42610671) has the molecular formula C30H34O12 and a molecular weight of 586.59 g/mol. Its IUPAC name is [(1S,2S,5S,9R,14R,15R,18R,21S,24R,26S)-14,15-dihydroxy-2,9,26-trimethyl-4,10,22,29-tetraoxo-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-en-5-yl] acetate.
| Compound Name | [(1S,2S,5S,9R,14R,15R,18R,21S,24R,26S)-14,15-dihydroxy-2,9,26-trimethyl-4,10,22,29-tetraoxo-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-en-5-yl] acetate |
|---|---|
| PubChem CID | 42610671 |
| Molecular Formula | C30H34O12 |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | [(1S,2S,5S,9R,14R,15R,18R,21S,24R,26S)-14,15-dihydroxy-2,9,26-trimethyl-4,10,22,29-tetraoxo-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-en-5-yl] acetate |
| SMILES | CC(=O)OC12CCC3C(CC(O)C4(O)CC=CC(=O)C34C)C34OCC5C(=O)OC6CC5(C)C(C3=O)C1(O4)C6(C)OC2=O |
| InChI | InChI=1S/C30H34O12/c1-13(31)40-28-9-7-14-15(10-18(33)27(37)8-5-6-17(32)25(14,27)3)29-21(34)20-24(2)11-19(39-22(35)16(24)12-38-29)26(4,41-23(28)36)30(20,28)42-29/h5-6,14-16,18-20,33,37H,7-12H2,1-4H3 |
| InChIKey | PPJWMJKNXDORCG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|