C28H30O10 — CID 23307832
(4R,6S,11R,15R,20S,21S,23R,26R)-15-hydroxy-11,18,21-trimethyl-5,17,24,28,29-pentaoxanonacyclo[17.9.1.11,20.02,12.04,6.06,11.015,19.018,23.021,26]triacont-8-ene-10,16,25,30-tetrone (PubChem CID 23307832) has the molecular formula C28H30O10 and a molecular weight of 526.54 g/mol. Its IUPAC name is (4R,6S,11R,15R,20S,21S,23R,26R)-15-hydroxy-11,18,21-trimethyl-5,17,24,28,29-pentaoxanonacyclo[17.9.1.11,20.02,12.04,6.06,11.015,19.018,23.021,26]triacont-8-ene-10,16,25,30-tetrone.
| Compound Name | (4R,6S,11R,15R,20S,21S,23R,26R)-15-hydroxy-11,18,21-trimethyl-5,17,24,28,29-pentaoxanonacyclo[17.9.1.11,20.02,12.04,6.06,11.015,19.018,23.021,26]triacont-8-ene-10,16,25,30-tetrone |
|---|---|
| PubChem CID | 23307832 |
| Molecular Formula | C28H30O10 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (4R,6S,11R,15R,20S,21S,23R,26R)-15-hydroxy-11,18,21-trimethyl-5,17,24,28,29-pentaoxanonacyclo[17.9.1.11,20.02,12.04,6.06,11.015,19.018,23.021,26]triacont-8-ene-10,16,25,30-tetrone |
| SMILES | CC12OC(=O)[C@@]3(O)CCC4C(C[C@H]5O[C@]56CC=CC(=O)[C@]46C)C45OC[C@@H]6C(=O)O[C@@H]1C[C@@]6(C)C(C4=O)C23O5 |
| InChI | InChI=1S/C28H30O10/c1-22-10-17-24(3)28-18(22)19(30)27(38-28,34-11-14(22)20(31)35-17)13-9-16-26(36-16)7-4-5-15(29)23(26,2)12(13)6-8-25(28,33)21(32)37-24/h4-5,12-14,16-18,33H,6-11H2,1-3H3/t12?,13?,14-,16-,17-,18?,22-,23+,24?,25+,26-,27?,28?/m1/s1 |
| InChIKey | VSLWNSSUMFSGFF-ODWLMQGOSA-N |
| XLogP | 0.77 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|