C27H30O10 — CID 58594647
(3R,5R,15R,19R,22S,23R)-5,19-dihydroxy-1,15,22-trimethyl-4,9,21,24-tetraoxaoctacyclo[21.3.1.12,5.03,19.03,22.06,16.08,10.010,15]octacos-12-ene-14,20,25,28-tetrone (PubChem CID 58594647) has the molecular formula C27H30O10 and a molecular weight of 514.53 g/mol. Its IUPAC name is (3R,5R,15R,19R,22S,23R)-5,19-dihydroxy-1,15,22-trimethyl-4,9,21,24-tetraoxaoctacyclo[21.3.1.12,5.03,19.03,22.06,16.08,10.010,15]octacos-12-ene-14,20,25,28-tetrone.
| Compound Name | (3R,5R,15R,19R,22S,23R)-5,19-dihydroxy-1,15,22-trimethyl-4,9,21,24-tetraoxaoctacyclo[21.3.1.12,5.03,19.03,22.06,16.08,10.010,15]octacos-12-ene-14,20,25,28-tetrone |
|---|---|
| PubChem CID | 58594647 |
| Molecular Formula | C27H30O10 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (3R,5R,15R,19R,22S,23R)-5,19-dihydroxy-1,15,22-trimethyl-4,9,21,24-tetraoxaoctacyclo[21.3.1.12,5.03,19.03,22.06,16.08,10.010,15]octacos-12-ene-14,20,25,28-tetrone |
| SMILES | CC12CC(=O)O[C@H](C1)[C@]1(C)OC(=O)[C@@]3(O)CCC4C(CC5OC56CC=CC(=O)[C@]46C)[C@@]4(O)O[C@@]13C2C4=O |
| InChI | InChI=1S/C27H30O10/c1-21-10-16(34-17(29)11-21)23(3)27-18(21)19(30)26(33,37-27)13-9-15-25(35-15)7-4-5-14(28)22(25,2)12(13)6-8-24(27,32)20(31)36-23/h4-5,12-13,15-16,18,32-33H,6-11H2,1-3H3/t12?,13?,15?,16-,18?,21?,22+,23+,24+,25?,26-,27+/m1/s1 |
| InChIKey | BKSWTFQITXKMCN-QHBITNSSSA-N |
| XLogP | 0.50 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|