C28H32O10 — CID 90264483
(1R,3R,5R,7S,14R,18S,21S,22R)-7,18-dihydroxy-5-methoxy-1,14,21-trimethyl-4,20,23-trioxaheptacyclo[20.3.1.12,5.03,18.03,21.06,15.09,14]heptacosa-8,11-diene-13,19,24,27-tetrone (PubChem CID 90264483) has the molecular formula C28H32O10 and a molecular weight of 528.55 g/mol. Its IUPAC name is (1R,3R,5R,7S,14R,18S,21S,22R)-7,18-dihydroxy-5-methoxy-1,14,21-trimethyl-4,20,23-trioxaheptacyclo[20.3.1.12,5.03,18.03,21.06,15.09,14]heptacosa-8,11-diene-13,19,24,27-tetrone.
| Compound Name | (1R,3R,5R,7S,14R,18S,21S,22R)-7,18-dihydroxy-5-methoxy-1,14,21-trimethyl-4,20,23-trioxaheptacyclo[20.3.1.12,5.03,18.03,21.06,15.09,14]heptacosa-8,11-diene-13,19,24,27-tetrone |
|---|---|
| PubChem CID | 90264483 |
| Molecular Formula | C28H32O10 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | (1R,3R,5R,7S,14R,18S,21S,22R)-7,18-dihydroxy-5-methoxy-1,14,21-trimethyl-4,20,23-trioxaheptacyclo[20.3.1.12,5.03,18.03,21.06,15.09,14]heptacosa-8,11-diene-13,19,24,27-tetrone |
| SMILES | CO[C@]12O[C@@]34C(C1=O)[C@@]1(C)CC(=O)O[C@H](C1)[C@]3(C)OC(=O)[C@]4(O)CCC1C2C(O)C=C2CC=CC(=O)[C@@]21C |
| InChI | InChI=1S/C28H32O10/c1-23-11-17(36-18(31)12-23)25(3)28-20(23)21(32)27(35-4,38-28)19-14(8-9-26(28,34)22(33)37-25)24(2)13(10-15(19)29)6-5-7-16(24)30/h5,7,10,14-15,17,19-20,29,34H,6,8-9,11-12H2,1-4H3/t14?,15?,17-,19?,20?,23-,24+,25+,26-,27-,28+/m1/s1 |
| InChIKey | XXFMFXNUPDRWMN-FONIEQHQSA-N |
| XLogP | 0.92 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|