C19H12FN5S — CID 42611388
6-(2-fluoro-4-pyridinyl)-3-(naphthalen-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 42611388) has the molecular formula C19H12FN5S and a molecular weight of 361.41 g/mol. Its IUPAC name is 6-(2-fluoro-4-pyridinyl)-3-(naphthalen-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(2-fluoro-4-pyridinyl)-3-(naphthalen-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 42611388 |
| Molecular Formula | C19H12FN5S |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 6-(2-fluoro-4-pyridinyl)-3-(naphthalen-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Fc1cc(-c2nn3c(Cc4cccc5ccccc45)nnc3s2)ccn1 |
| InChI | InChI=1S/C19H12FN5S/c20-16-10-14(8-9-21-16)18-24-25-17(22-23-19(25)26-18)11-13-6-3-5-12-4-1-2-7-15(12)13/h1-10H,11H2 |
| InChIKey | PJMCQWRIBJKDHZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|