C12H18N4O3 — CID 42611649
tert-butyl (2S,6S)-4-oxa-1,7,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-7-carboxylate (PubChem CID 42611649) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is tert-butyl (2S,6S)-4-oxa-1,7,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-7-carboxylate.
| Compound Name | tert-butyl (2S,6S)-4-oxa-1,7,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-7-carboxylate |
|---|---|
| PubChem CID | 42611649 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | tert-butyl (2S,6S)-4-oxa-1,7,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cnnn2[C@@H]2COC[C@H]21 |
| InChI | InChI=1S/C12H18N4O3/c1-12(2,3)19-11(17)15-5-8-4-13-14-16(8)10-7-18-6-9(10)15/h4,9-10H,5-7H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | PQWKQLMGZLJWDM-NXEZZACHSA-N |
| XLogP | 0.97 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |