C28H25NO2S — CID 42611973
(1R,12R)-9-benzyl-16-methoxy-20,20-dimethyl-19-thia-9-azapentacyclo[10.8.0.02,10.03,8.013,18]icosa-2(10),3,5,7,13(18),14,16-heptaen-11-one (PubChem CID 42611973) has the molecular formula C28H25NO2S and a molecular weight of 439.58 g/mol. Its IUPAC name is (1R,12R)-9-benzyl-16-methoxy-20,20-dimethyl-19-thia-9-azapentacyclo[10.8.0.02,10.03,8.013,18]icosa-2(10),3,5,7,13(18),14,16-heptaen-11-one.
| Compound Name | (1R,12R)-9-benzyl-16-methoxy-20,20-dimethyl-19-thia-9-azapentacyclo[10.8.0.02,10.03,8.013,18]icosa-2(10),3,5,7,13(18),14,16-heptaen-11-one |
|---|---|
| PubChem CID | 42611973 |
| Molecular Formula | C28H25NO2S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (1R,12R)-9-benzyl-16-methoxy-20,20-dimethyl-19-thia-9-azapentacyclo[10.8.0.02,10.03,8.013,18]icosa-2(10),3,5,7,13(18),14,16-heptaen-11-one |
| SMILES | COc1ccc2c(c1)SC(C)(C)[C@H]1c3c(n(Cc4ccccc4)c4ccccc34)C(=O)[C@@H]21 |
| InChI | InChI=1S/C28H25NO2S/c1-28(2)25-23-19-11-7-8-12-21(19)29(16-17-9-5-4-6-10-17)26(23)27(30)24(25)20-14-13-18(31-3)15-22(20)32-28/h4-15,24-25H,16H2,1-3H3/t24-,25-/m0/s1 |
| InChIKey | VKJCZADZXFNTGF-DQEYMECFSA-N |
| XLogP | 6.65 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|