C11H6Br3F2NO — CID 42613053
2,3,4-tribromo-5-(2,6-difluoro-3-methoxyphenyl)-1H-pyrrole (PubChem CID 42613053) has the molecular formula C11H6Br3F2NO and a molecular weight of 445.88 g/mol. Its IUPAC name is 2,3,4-tribromo-5-(2,6-difluoro-3-methoxyphenyl)-1H-pyrrole.
| Compound Name | 2,3,4-tribromo-5-(2,6-difluoro-3-methoxyphenyl)-1H-pyrrole |
|---|---|
| PubChem CID | 42613053 |
| Molecular Formula | C11H6Br3F2NO |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 442.80 |
| IUPAC Name | 2,3,4-tribromo-5-(2,6-difluoro-3-methoxyphenyl)-1H-pyrrole |
| SMILES | COc1ccc(F)c(-c2[nH]c(Br)c(Br)c2Br)c1F |
| InChI | InChI=1S/C11H6Br3F2NO/c1-18-5-3-2-4(15)6(9(5)16)10-7(12)8(13)11(14)17-10/h2-3,17H,1H3 |
| InChIKey | NBFUSEBTBDTSDO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |