C34H56O4 — CID 42622286
3-[(1S,4S)-4-hydroxy-5-(hydroxymethyl)cyclohex-2-en-1-yl]oxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-ol (PubChem CID 42622286) has the molecular formula C34H56O4 and a molecular weight of 528.82 g/mol. Its IUPAC name is 3-[(1S,4S)-4-hydroxy-5-(hydroxymethyl)cyclohex-2-en-1-yl]oxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-ol.
| Compound Name | 3-[(1S,4S)-4-hydroxy-5-(hydroxymethyl)cyclohex-2-en-1-yl]oxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-ol |
|---|---|
| PubChem CID | 42622286 |
| Molecular Formula | C34H56O4 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.42 |
| IUPAC Name | 3-[(1S,4S)-4-hydroxy-5-(hydroxymethyl)cyclohex-2-en-1-yl]oxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-ol |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3C(O)C=C4CC(O[C@@H]5C=C[C@H](O)C(CO)C5)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C34H56O4/c1-21(2)7-6-8-22(3)27-10-11-28-32-29(14-16-34(27,28)5)33(4)15-13-26(18-24(33)19-31(32)37)38-25-9-12-30(36)23(17-25)20-35/h9,12,19,21-23,25-32,35-37H,6-8,10-11,13-18,20H2,1-5H3/t22-,23?,25-,26?,27?,28?,29?,30+,31?,32?,33?,34?/m1/s1 |
| InChIKey | CPKDNOVXWZYKDC-ACHCOQNZSA-N |
| XLogP | 6.68 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|