C24H25ClN4S — CID 42624830
2-[6-(4-benzylpiperidin-1-yl)pyridazin-3-yl]-2-(4-chlorophenyl)ethanethioamide (PubChem CID 42624830) has the molecular formula C24H25ClN4S and a molecular weight of 437.01 g/mol. Its IUPAC name is 2-[6-(4-benzylpiperidin-1-yl)pyridazin-3-yl]-2-(4-chlorophenyl)ethanethioamide.
| Compound Name | 2-[6-(4-benzylpiperidin-1-yl)pyridazin-3-yl]-2-(4-chlorophenyl)ethanethioamide |
|---|---|
| PubChem CID | 42624830 |
| Molecular Formula | C24H25ClN4S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-[6-(4-benzylpiperidin-1-yl)pyridazin-3-yl]-2-(4-chlorophenyl)ethanethioamide |
| SMILES | NC(=S)C(c1ccc(Cl)cc1)c1ccc(N2CCC(Cc3ccccc3)CC2)nn1 |
| InChI | InChI=1S/C24H25ClN4S/c25-20-8-6-19(7-9-20)23(24(26)30)21-10-11-22(28-27-21)29-14-12-18(13-15-29)16-17-4-2-1-3-5-17/h1-11,18,23H,12-16H2,(H2,26,30) |
| InChIKey | JSVLVXYSVPJMBZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|