C12H13BrN2O2S — CID 42625455
2-(4-bromophenyl)imino-3-(2-methoxyethyl)-1,3-thiazolidin-4-one (PubChem CID 42625455) has the molecular formula C12H13BrN2O2S and a molecular weight of 329.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)imino-3-(2-methoxyethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-bromophenyl)imino-3-(2-methoxyethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 42625455 |
| Molecular Formula | C12H13BrN2O2S |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 2-(4-bromophenyl)imino-3-(2-methoxyethyl)-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)CS/C1=N\c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrN2O2S/c1-17-7-6-15-11(16)8-18-12(15)14-10-4-2-9(13)3-5-10/h2-5H,6-8H2,1H3/b14-12- |
| InChIKey | IPPFVXGIONVYOZ-OWBHPGMISA-N |
| XLogP | 2.66 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|