C30H36BrNO2 — CID 42626018
[1-[2-[(3-methylphenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide (PubChem CID 42626018) has the molecular formula C30H36BrNO2 and a molecular weight of 522.53 g/mol. Its IUPAC name is [1-[2-[(3-methylphenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide.
| Compound Name | [1-[2-[(3-methylphenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide |
|---|---|
| PubChem CID | 42626018 |
| Molecular Formula | C30H36BrNO2 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | [1-[2-[(3-methylphenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide |
| SMILES | Cc1cccc(COCC[N+]23CCC(C(O)(c4ccccc4)c4ccccc4)(CC2)CC3)c1.[Br-] |
| InChI | InChI=1S/C30H36NO2.BrH/c1-25-9-8-10-26(23-25)24-33-22-21-31-18-15-29(16-19-31,17-20-31)30(32,27-11-4-2-5-12-27)28-13-6-3-7-14-28;/h2-14,23,32H,15-22,24H2,1H3;1H/q+1;/p-1 |
| InChIKey | XLMWLFZADLUISU-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|