C33H33F3N2O9 — CID 42626283
N-[(2R,3S,6S,7R,8R)-8-benzyl-7-hydroxy-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-3-yl]-2-hydroxy-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]benzamide (PubChem CID 42626283) has the molecular formula C33H33F3N2O9 and a molecular weight of 658.63 g/mol. Its IUPAC name is N-[(2R,3S,6S,7R,8R)-8-benzyl-7-hydroxy-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-3-yl]-2-hydroxy-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]benzamide.
| Compound Name | N-[(2R,3S,6S,7R,8R)-8-benzyl-7-hydroxy-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-3-yl]-2-hydroxy-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]benzamide |
|---|---|
| PubChem CID | 42626283 |
| Molecular Formula | C33H33F3N2O9 |
| Molecular Weight | 658.63 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | N-[(2R,3S,6S,7R,8R)-8-benzyl-7-hydroxy-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-3-yl]-2-hydroxy-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]benzamide |
| SMILES | CO[C@@](C(=O)Nc1cccc(C(=O)N[C@@H]2C(=O)O[C@@H](C)[C@H](O)[C@@H](Cc3ccccc3)C(=O)O[C@@H]2C)c1O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H33F3N2O9/c1-18-25(30(43)47-19(2)26(39)23(29(42)46-18)17-20-11-6-4-7-12-20)38-28(41)22-15-10-16-24(27(22)40)37-31(44)32(45-3,33(34,35)36)21-13-8-5-9-14-21/h4-16,18-19,23,25-26,39-40H,17H2,1-3H3,(H,37,44)(H,38,41)/t18-,19+,23-,25+,26+,32-/m1/s1 |
| InChIKey | MBHIXAYXMIZFFB-MELFSWJUSA-N |
| XLogP | 3.63 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|