C18H14F3NO2 — CID 42628284
4-phenyl-1-[4-(trifluoromethyl)phenyl]piperidine-2,6-dione (PubChem CID 42628284) has the molecular formula C18H14F3NO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 4-phenyl-1-[4-(trifluoromethyl)phenyl]piperidine-2,6-dione.
| Compound Name | 4-phenyl-1-[4-(trifluoromethyl)phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 42628284 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-phenyl-1-[4-(trifluoromethyl)phenyl]piperidine-2,6-dione |
| SMILES | O=C1CC(c2ccccc2)CC(=O)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F3NO2/c19-18(20,21)14-6-8-15(9-7-14)22-16(23)10-13(11-17(22)24)12-4-2-1-3-5-12/h1-9,13H,10-11H2 |
| InChIKey | RIUDGRIDBMLILZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|