About 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile
3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile (PubChem CID 42630744) has the molecular formula C22H32N4O4
and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile.
Molecular Properties
| Compound Name | 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile |
| PubChem CID | 42630744 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile |
| SMILES | N#CCCOCC1CC(COCCC#N)C(COCCC#N)CC1COCCC#N |
| InChI | InChI=1S/C22H32N4O4/c23-5-1-9-27-15-19-13-21(17-29-11-3-7-25)22(18-30-12-4-8-26)14-20(19)16-28-10-2-6-24/h19-22H,1-4,9-18H2 |
| InChIKey | CCZTVVBZUCBQOJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 132.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile?
The IUPAC name of 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile (CID 42630744) is 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile.
What is the SMILES notation for 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile?
The canonical SMILES for 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile is N#CCCOCC1CC(COCCC#N)C(COCCC#N)CC1COCCC#N.
What is the InChIKey of 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile?
The InChIKey is CCZTVVBZUCBQOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N4O4/c23-5-1-9-27-15-19-13-21(17-29-11-3-7-25)22(18-30-12-4-8-26)14-20(19)16-28-10-2-6-24/h19-22H,1-4,9-18H2.
What are the key properties of 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile?
3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile has a molecular weight of 416.52 g/mol, XLogP of 2.97, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile is sourced from PubChem (CID 42630744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).