C22H32N4O4 — CID 42630744
3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile (PubChem CID 42630744) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile.
| Compound Name | 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile |
|---|---|
| PubChem CID | 42630744 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 3-[[2,4,5-tris(2-cyanoethoxymethyl)cyclohexyl]methoxy]propanenitrile |
| SMILES | N#CCCOCC1CC(COCCC#N)C(COCCC#N)CC1COCCC#N |
| InChI | InChI=1S/C22H32N4O4/c23-5-1-9-27-15-19-13-21(17-29-11-3-7-25)22(18-30-12-4-8-26)14-20(19)16-28-10-2-6-24/h19-22H,1-4,9-18H2 |
| InChIKey | CCZTVVBZUCBQOJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 132.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|