C23H30N4O7 — CID 101103285
2-[(3S,4R,5R,6R)-3,4,5-tris(2-cyanoethoxy)-6-(2-cyanoethoxymethyl)oxan-2-yl]ethyl prop-2-enoate (PubChem CID 101103285) has the molecular formula C23H30N4O7 and a molecular weight of 474.51 g/mol. Its IUPAC name is 2-[(3S,4R,5R,6R)-3,4,5-tris(2-cyanoethoxy)-6-(2-cyanoethoxymethyl)oxan-2-yl]ethyl prop-2-enoate.
| Compound Name | 2-[(3S,4R,5R,6R)-3,4,5-tris(2-cyanoethoxy)-6-(2-cyanoethoxymethyl)oxan-2-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 101103285 |
| Molecular Formula | C23H30N4O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-[(3S,4R,5R,6R)-3,4,5-tris(2-cyanoethoxy)-6-(2-cyanoethoxymethyl)oxan-2-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC1O[C@H](COCCC#N)[C@@H](OCCC#N)[C@H](OCCC#N)[C@H]1OCCC#N |
| InChI | InChI=1S/C23H30N4O7/c1-2-20(28)30-16-7-18-21(31-13-4-9-25)23(33-15-6-11-27)22(32-14-5-10-26)19(34-18)17-29-12-3-8-24/h2,18-19,21-23H,1,3-7,12-17H2/t18?,19-,21+,22-,23-/m1/s1 |
| InChIKey | BTNHWQFZQYRQAY-CVQJMCFOSA-N |
| XLogP | 1.70 |
| TPSA | 167.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|