C10H13NO5 — CID 156542048
2-(2-prop-2-enoyloxyethoxy)ethyl 2-cyanoacetate (PubChem CID 156542048) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-(2-prop-2-enoyloxyethoxy)ethyl 2-cyanoacetate.
| Compound Name | 2-(2-prop-2-enoyloxyethoxy)ethyl 2-cyanoacetate |
|---|---|
| PubChem CID | 156542048 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-(2-prop-2-enoyloxyethoxy)ethyl 2-cyanoacetate |
| SMILES | C=CC(=O)OCCOCCOC(=O)CC#N |
| InChI | InChI=1S/C10H13NO5/c1-2-9(12)15-7-5-14-6-8-16-10(13)3-4-11/h2H,1,3,5-8H2 |
| InChIKey | FMIHQGQEXSKFET-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|