C17H29N3O2 — CID 42631177
2-ethoxy-N'-nonan-5-ylpyridine-3-carbohydrazide (PubChem CID 42631177) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-ethoxy-N'-nonan-5-ylpyridine-3-carbohydrazide.
| Compound Name | 2-ethoxy-N'-nonan-5-ylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 42631177 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-ethoxy-N'-nonan-5-ylpyridine-3-carbohydrazide |
| SMILES | CCCCC(CCCC)NNC(=O)c1cccnc1OCC |
| InChI | InChI=1S/C17H29N3O2/c1-4-7-10-14(11-8-5-2)19-20-16(21)15-12-9-13-18-17(15)22-6-3/h9,12-14,19H,4-8,10-11H2,1-3H3,(H,20,21) |
| InChIKey | LYQHUJXIJVKMSH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|