C31H42N4O4 — CID 42631389
tert-butyl N-[(2S)-1-[2-[4-(1-adamantyl)quinoline-2-carbonyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 42631389) has the molecular formula C31H42N4O4 and a molecular weight of 534.70 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[2-[4-(1-adamantyl)quinoline-2-carbonyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[2-[4-(1-adamantyl)quinoline-2-carbonyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 42631389 |
| Molecular Formula | C31H42N4O4 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | tert-butyl N-[(2S)-1-[2-[4-(1-adamantyl)quinoline-2-carbonyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)NNC(=O)c1cc(C23CC4CC(CC(C4)C2)C3)c2ccccc2n1 |
| InChI | InChI=1S/C31H42N4O4/c1-18(2)10-25(33-29(38)39-30(3,4)5)27(36)34-35-28(37)26-14-23(22-8-6-7-9-24(22)32-26)31-15-19-11-20(16-31)13-21(12-19)17-31/h6-9,14,18-21,25H,10-13,15-17H2,1-5H3,(H,33,38)(H,34,36)(H,35,37)/t19?,20?,21?,25-,31?/m0/s1 |
| InChIKey | SOXYVVNBBZZNOW-JRFQZHANSA-N |
| XLogP | 5.40 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|