C21H15BrN2O3 — CID 4263162
4-[(1-acetyl-5-bromoindol-3-yl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one (PubChem CID 4263162) has the molecular formula C21H15BrN2O3 and a molecular weight of 423.27 g/mol. Its IUPAC name is 4-[(1-acetyl-5-bromoindol-3-yl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(1-acetyl-5-bromoindol-3-yl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4263162 |
| Molecular Formula | C21H15BrN2O3 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 4-[(1-acetyl-5-bromoindol-3-yl)methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
| SMILES | CC(=O)n1cc(C=C2N=C(c3ccccc3C)OC2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C21H15BrN2O3/c1-12-5-3-4-6-16(12)20-23-18(21(26)27-20)9-14-11-24(13(2)25)19-8-7-15(22)10-17(14)19/h3-11H,1-2H3 |
| InChIKey | BXYRAMAQKDLIEU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|