C19H25N5O3 — CID 42631817
6-amino-1,3-dimethyl-5-[[3-(2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]pyrimidine-2,4-dione (PubChem CID 42631817) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-[[3-(2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1,3-dimethyl-5-[[3-(2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 42631817 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-[[3-(2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]pyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(/N=C/c2cccc(OCCN3CCCC3)c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C19H25N5O3/c1-22-17(20)16(18(25)23(2)19(22)26)21-13-14-6-5-7-15(12-14)27-11-10-24-8-3-4-9-24/h5-7,12-13H,3-4,8-11,20H2,1-2H3/b21-13+ |
| InChIKey | IGZGNIDVQLXCFH-FYJGNVAPSA-N |
| XLogP | 0.89 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|