C18H14F3N3O3S — CID 42635094
6-(4-methylsulfonylphenyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine (PubChem CID 42635094) has the molecular formula C18H14F3N3O3S and a molecular weight of 409.39 g/mol. Its IUPAC name is 6-(4-methylsulfonylphenyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine.
| Compound Name | 6-(4-methylsulfonylphenyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 42635094 |
| Molecular Formula | C18H14F3N3O3S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 6-(4-methylsulfonylphenyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)cc1 |
| InChI | InChI=1S/C18H14F3N3O3S/c1-28(25,26)15-8-2-12(3-9-15)16-10-17(23-11-22-16)24-13-4-6-14(7-5-13)27-18(19,20)21/h2-11H,1H3,(H,22,23,24) |
| InChIKey | CZGACSOVIFVXIS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |