C11H15NO3 — CID 42640042
methyl (2E,4Z)-5-(3-methylbut-2-enoylamino)penta-2,4-dienoate (PubChem CID 42640042) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is methyl (2E,4Z)-5-(3-methylbut-2-enoylamino)penta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-5-(3-methylbut-2-enoylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 42640042 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | methyl (2E,4Z)-5-(3-methylbut-2-enoylamino)penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C\NC(=O)C=C(C)C |
| InChI | InChI=1S/C11H15NO3/c1-9(2)8-10(13)12-7-5-4-6-11(14)15-3/h4-8H,1-3H3,(H,12,13)/b6-4+,7-5- |
| InChIKey | CKDIDTNWKBTCET-GUBXDBFYSA-N |
| XLogP | 1.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|