C15H23NO5 — CID 101473302
methyl (2E,4Z)-5-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]penta-2,4-dienoate (PubChem CID 101473302) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl (2E,4Z)-5-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]penta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-5-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]penta-2,4-dienoate |
|---|---|
| PubChem CID | 101473302 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | methyl (2E,4Z)-5-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C\NC(=O)[C@H]1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C15H23NO5/c1-14(2)10-20-15(3,4)21-12(14)13(18)16-9-7-6-8-11(17)19-5/h6-9,12H,10H2,1-5H3,(H,16,18)/b8-6+,9-7-/t12-/m1/s1 |
| InChIKey | UZXINPJZMPUMJF-KEVAMGHASA-N |
| XLogP | 1.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|