C9H17NO3 — CID 11252443
(4S)-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide (PubChem CID 11252443) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (4S)-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide.
| Compound Name | (4S)-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide |
|---|---|
| PubChem CID | 11252443 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (4S)-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide |
| SMILES | CC1(C)OCC(C)(C)[C@@H](C(N)=O)O1 |
| InChI | InChI=1S/C9H17NO3/c1-8(2)5-12-9(3,4)13-6(8)7(10)11/h6H,5H2,1-4H3,(H2,10,11)/t6-/m1/s1 |
| InChIKey | ADYNAHLVLCVHSN-ZCFIWIBFSA-N |
| XLogP | 0.65 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |