C19H21N4O2+ — CID 42643768
4-tert-butyl-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzamide (PubChem CID 42643768) has the molecular formula C19H21N4O2+ and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzamide |
|---|---|
| PubChem CID | 42643768 |
| Molecular Formula | C19H21N4O2+ |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-tert-butyl-N-[4-(5-methyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzamide |
| SMILES | Cc1nnc(-c2cc[n+](NC(=O)c3ccc(C(C)(C)C)cc3)cc2)o1 |
| InChI | InChI=1S/C19H20N4O2/c1-13-20-21-18(25-13)15-9-11-23(12-10-15)22-17(24)14-5-7-16(8-6-14)19(2,3)4/h5-12H,1-4H3/p+1 |
| InChIKey | VLIXAPHTGQFERX-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 71.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|