C12H18OSi — CID 42644270
trimethyl-[(1S,7R)-3-oxatricyclo[5.2.1.02,4]deca-5,8-dien-9-yl]silane (PubChem CID 42644270) has the molecular formula C12H18OSi and a molecular weight of 206.36 g/mol. Its IUPAC name is trimethyl-[(1S,7R)-3-oxatricyclo[5.2.1.02,4]deca-5,8-dien-9-yl]silane.
| Compound Name | trimethyl-[(1S,7R)-3-oxatricyclo[5.2.1.02,4]deca-5,8-dien-9-yl]silane |
|---|---|
| PubChem CID | 42644270 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | trimethyl-[(1S,7R)-3-oxatricyclo[5.2.1.02,4]deca-5,8-dien-9-yl]silane |
| SMILES | C[Si](C)(C)C1=C[C@H]2C=CC3OC3[C@@H]1C2 |
| InChI | InChI=1S/C12H18OSi/c1-14(2,3)11-7-8-4-5-10-12(13-10)9(11)6-8/h4-5,7-10,12H,6H2,1-3H3/t8-,9+,10?,12?/m0/s1 |
| InChIKey | FBBIYOORYWYLPX-SKMKEBHYSA-N |
| XLogP | 2.76 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|