About N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide
N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide (PubChem CID 42645602) has the molecular formula C24H32N2O3
and a molecular weight of 396.53 g/mol. Its IUPAC name is N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide.
Molecular Properties
| Compound Name | N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide |
| PubChem CID | 42645602 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide |
| SMILES | CCCCC(CCCC)N(NC(=O)c1cccc(OC)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O3/c1-4-6-15-21(16-7-5-2)26(24(28)19-12-9-8-10-13-19)25-23(27)20-14-11-17-22(18-20)29-3/h8-14,17-18,21H,4-7,15-16H2,1-3H3,(H,25,27) |
| InChIKey | NWYPYYCNKKIFEL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide?
The IUPAC name of N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide (CID 42645602) is N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide.
What is the SMILES notation for N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide?
The canonical SMILES for N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide is CCCCC(CCCC)N(NC(=O)c1cccc(OC)c1)C(=O)c1ccccc1.
What is the InChIKey of N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide?
The InChIKey is NWYPYYCNKKIFEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32N2O3/c1-4-6-15-21(16-7-5-2)26(24(28)19-12-9-8-10-13-19)25-23(27)20-14-11-17-22(18-20)29-3/h8-14,17-18,21H,4-7,15-16H2,1-3H3,(H,25,27).
What are the key properties of N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide?
N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide has a molecular weight of 396.53 g/mol, XLogP of 5.23, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzoyl-3-methoxy-N'-nonan-5-ylbenzohydrazide is sourced from PubChem (CID 42645602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).