C20H39NO3 — CID 42645677
(2S,3R,4E)-2-(hydroxymethyl)-4-[(2R)-2-hydroxytetradecylidene]piperidin-3-ol (PubChem CID 42645677) has the molecular formula C20H39NO3 and a molecular weight of 341.54 g/mol. Its IUPAC name is (2S,3R,4E)-2-(hydroxymethyl)-4-[(2R)-2-hydroxytetradecylidene]piperidin-3-ol.
| Compound Name | (2S,3R,4E)-2-(hydroxymethyl)-4-[(2R)-2-hydroxytetradecylidene]piperidin-3-ol |
|---|---|
| PubChem CID | 42645677 |
| Molecular Formula | C20H39NO3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | (2S,3R,4E)-2-(hydroxymethyl)-4-[(2R)-2-hydroxytetradecylidene]piperidin-3-ol |
| SMILES | CCCCCCCCCCCC[C@@H](O)/C=C1\CCN[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C20H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-18(23)15-17-13-14-21-19(16-22)20(17)24/h15,18-24H,2-14,16H2,1H3/b17-15+/t18-,19+,20-/m1/s1 |
| InChIKey | VPYDUEZAQNTBEI-GXNUSPADSA-N |
| XLogP | 3.30 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|