C11H12F2O6S — CID 42647130
ethyl 3-(benzenesulfonyl)-3,3-difluoro-2,2-dihydroxypropanoate (PubChem CID 42647130) has the molecular formula C11H12F2O6S and a molecular weight of 310.27 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonyl)-3,3-difluoro-2,2-dihydroxypropanoate.
| Compound Name | ethyl 3-(benzenesulfonyl)-3,3-difluoro-2,2-dihydroxypropanoate |
|---|---|
| PubChem CID | 42647130 |
| Molecular Formula | C11H12F2O6S |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | ethyl 3-(benzenesulfonyl)-3,3-difluoro-2,2-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)(O)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12F2O6S/c1-2-19-9(14)10(15,16)11(12,13)20(17,18)8-6-4-3-5-7-8/h3-7,15-16H,2H2,1H3 |
| InChIKey | WRKJCXKDYSXLOZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|