C19H26N4O3 — CID 42651309
2-[4-[2-(dimethylamino)-2-oxoethyl]piperazin-1-yl]-2-(5-methyl-1H-indol-3-yl)acetic acid (PubChem CID 42651309) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-[4-[2-(dimethylamino)-2-oxoethyl]piperazin-1-yl]-2-(5-methyl-1H-indol-3-yl)acetic acid.
| Compound Name | 2-[4-[2-(dimethylamino)-2-oxoethyl]piperazin-1-yl]-2-(5-methyl-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 42651309 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-[4-[2-(dimethylamino)-2-oxoethyl]piperazin-1-yl]-2-(5-methyl-1H-indol-3-yl)acetic acid |
| SMILES | Cc1ccc2[nH]cc(C(C(=O)O)N3CCN(CC(=O)N(C)C)CC3)c2c1 |
| InChI | InChI=1S/C19H26N4O3/c1-13-4-5-16-14(10-13)15(11-20-16)18(19(25)26)23-8-6-22(7-9-23)12-17(24)21(2)3/h4-5,10-11,18,20H,6-9,12H2,1-3H3,(H,25,26) |
| InChIKey | GKFADHBWLXZCLM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |