C19H25N3O2 — CID 42651553
2-(2-methyl-1H-indol-3-yl)-2-[4-(2-methylprop-2-enyl)piperazin-1-yl]acetic acid (PubChem CID 42651553) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-2-[4-(2-methylprop-2-enyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-2-[4-(2-methylprop-2-enyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 42651553 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-2-[4-(2-methylprop-2-enyl)piperazin-1-yl]acetic acid |
| SMILES | C=C(C)CN1CCN(C(C(=O)O)c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H25N3O2/c1-13(2)12-21-8-10-22(11-9-21)18(19(23)24)17-14(3)20-16-7-5-4-6-15(16)17/h4-7,18,20H,1,8-12H2,2-3H3,(H,23,24) |
| InChIKey | BXMZLWBNRMJNRJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|