C17H22N2O3 — CID 71490363
ethyl 2-(2-methyl-1H-indol-3-yl)-2-morpholin-4-ylacetate (PubChem CID 71490363) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl 2-(2-methyl-1H-indol-3-yl)-2-morpholin-4-ylacetate.
| Compound Name | ethyl 2-(2-methyl-1H-indol-3-yl)-2-morpholin-4-ylacetate |
|---|---|
| PubChem CID | 71490363 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | ethyl 2-(2-methyl-1H-indol-3-yl)-2-morpholin-4-ylacetate |
| SMILES | CCOC(=O)C(c1c(C)[nH]c2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C17H22N2O3/c1-3-22-17(20)16(19-8-10-21-11-9-19)15-12(2)18-14-7-5-4-6-13(14)15/h4-7,16,18H,3,8-11H2,1-2H3 |
| InChIKey | LITPDYBZHUZZGF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|