C19H20N6 — CID 4265201
N,N-dimethyl-4-[5-(4-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]aniline (PubChem CID 4265201) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-(4-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]aniline.
| Compound Name | N,N-dimethyl-4-[5-(4-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]aniline |
|---|---|
| PubChem CID | 4265201 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N,N-dimethyl-4-[5-(4-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl]aniline |
| SMILES | Cc1ccc(C2=CC(c3ccc(N(C)C)cc3)n3nnnc3N2)cc1 |
| InChI | InChI=1S/C19H20N6/c1-13-4-6-14(7-5-13)17-12-18(25-19(20-17)21-22-23-25)15-8-10-16(11-9-15)24(2)3/h4-12,18H,1-3H3,(H,20,21,23) |
| InChIKey | IGPQRWQMGLHBLQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|