C16H26N6 — CID 1817984
1-butyl-N-[4-(diethylamino)benzyl]-1H-tetrazol-5-amine (PubChem CID 1817984) has the molecular formula C16H26N6 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-butyl-N-[[4-(diethylamino)phenyl]methyl]tetrazol-5-amine.
| Compound Name | 1-butyl-N-[4-(diethylamino)benzyl]-1H-tetrazol-5-amine |
|---|---|
| PubChem CID | 1817984 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-butyl-N-[[4-(diethylamino)phenyl]methyl]tetrazol-5-amine |
| SMILES | CCCCN1C(=NN=N1)NCC2=CC=C(C=C2)N(CC)CC |
| InChI | InChI=1S/C16H26N6/c1-4-7-12-22-16(18-19-20-22)17-13-14-8-10-15(11-9-14)21(5-2)6-3/h8-11H,4-7,12-13H2,1-3H3,(H,17,18,20) |
| InChIKey | YZYFGMNTORILAM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | 288 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|