C17H25N3O4S — CID 42655176
(2S,3R)-2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-methyl-N-phenylpentanamide (PubChem CID 42655176) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is (2S,3R)-2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-methyl-N-phenylpentanamide.
| Compound Name | (2S,3R)-2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-methyl-N-phenylpentanamide |
|---|---|
| PubChem CID | 42655176 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (2S,3R)-2-[(1,1-dioxothiolan-3-yl)carbamoylamino]-3-methyl-N-phenylpentanamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)NC1CCS(=O)(=O)C1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H25N3O4S/c1-3-12(2)15(16(21)18-13-7-5-4-6-8-13)20-17(22)19-14-9-10-25(23,24)11-14/h4-8,12,14-15H,3,9-11H2,1-2H3,(H,18,21)(H2,19,20,22)/t12-,14?,15+/m1/s1 |
| InChIKey | BVKKAYVCTAOKGD-ATFAPYMMSA-N |
| XLogP | 1.53 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |